C7H9IO4 — CID 76764420
(1R,2R,3R,5R)-3-iodo-2-methoxy-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 76764420) has the molecular formula C7H9IO4 and a molecular weight of 284.05 g/mol. Its IUPAC name is (1R,2R,3R,5R)-3-iodo-2-methoxy-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1R,2R,3R,5R)-3-iodo-2-methoxy-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 76764420 |
| Molecular Formula | C7H9IO4 |
| Molecular Weight | 284.05 g/mol |
| Exact Mass | 283.95 |
| IUPAC Name | (1R,2R,3R,5R)-3-iodo-2-methoxy-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | CO[C@@H]1[C@H]2CO[C@H](O2)C(=O)[C@@H]1I |
| InChI | InChI=1S/C7H9IO4/c1-10-6-3-2-11-7(12-3)5(9)4(6)8/h3-4,6-7H,2H2,1H3/t3-,4+,6-,7-/m1/s1 |
| InChIKey | VVVGXQROHHSPJJ-GFKUXRSRSA-N |
| XLogP | 0.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.05 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|