C8H9IO5 — CID 76764376
[(1R,2R,3R,5R)-3-iodo-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate (PubChem CID 76764376) has the molecular formula C8H9IO5 and a molecular weight of 312.06 g/mol. Its IUPAC name is [(1R,2R,3R,5R)-3-iodo-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate.
| Compound Name | [(1R,2R,3R,5R)-3-iodo-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate |
|---|---|
| PubChem CID | 76764376 |
| Molecular Formula | C8H9IO5 |
| Molecular Weight | 312.06 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | [(1R,2R,3R,5R)-3-iodo-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2CO[C@H](O2)C(=O)[C@@H]1I |
| InChI | InChI=1S/C8H9IO5/c1-3(10)13-7-4-2-12-8(14-4)6(11)5(7)9/h4-5,7-8H,2H2,1H3/t4-,5+,7-,8-/m1/s1 |
| InChIKey | NIECNLQVPHTJMQ-IXROVEORSA-N |
| XLogP | 0.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.06 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|