C12H11ClFO2- — CID 7678896
1-(2-chloro-6-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 7678896) has the molecular formula C12H11ClFO2- and a molecular weight of 241.67 g/mol. Its IUPAC name is 1-(2-chloro-6-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | 1-(2-chloro-6-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 7678896 |
| Molecular Formula | C12H11ClFO2- |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 1-(2-chloro-6-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | O=C([O-])C1(c2c(F)cccc2Cl)CCCC1 |
| InChI | InChI=1S/C12H12ClFO2/c13-8-4-3-5-9(14)10(8)12(11(15)16)6-1-2-7-12/h3-5H,1-2,6-7H2,(H,15,16)/p-1 |
| InChIKey | XFWCGCJZUQAJGP-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |