C26H35N5O5 — CID 76819389
tert-butyl 3-aminooxy-4-[3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-oxopiperidin-1-yl]pyrrolidine-1-carboxylate (PubChem CID 76819389) has the molecular formula C26H35N5O5 and a molecular weight of 497.60 g/mol. Its IUPAC name is tert-butyl 3-aminooxy-4-[3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-oxopiperidin-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-aminooxy-4-[3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-oxopiperidin-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 76819389 |
| Molecular Formula | C26H35N5O5 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | tert-butyl 3-aminooxy-4-[3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-oxopiperidin-1-yl]pyrrolidine-1-carboxylate |
| SMILES | COc1cc(C=C2CCCN(C3CN(C(=O)OC(C)(C)C)CC3ON)C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H35N5O5/c1-17-13-30(16-28-17)20-9-8-18(12-22(20)34-5)11-19-7-6-10-31(24(19)32)21-14-29(15-23(21)36-27)25(33)35-26(2,3)4/h8-9,11-13,16,21,23H,6-7,10,14-15,27H2,1-5H3 |
| InChIKey | XESANRPOFFUOGQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|