C26H21NO5S — CID 76825538
2-benzo[g][1,3]benzothiazol-2-yl-2-[2-(4-methoxyphenyl)ethenyl]-5,5-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 76825538) has the molecular formula C26H21NO5S and a molecular weight of 459.52 g/mol. Its IUPAC name is 2-benzo[g][1,3]benzothiazol-2-yl-2-[2-(4-methoxyphenyl)ethenyl]-5,5-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 2-benzo[g][1,3]benzothiazol-2-yl-2-[2-(4-methoxyphenyl)ethenyl]-5,5-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 76825538 |
| Molecular Formula | C26H21NO5S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 2-benzo[g][1,3]benzothiazol-2-yl-2-[2-(4-methoxyphenyl)ethenyl]-5,5-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1ccc(C=CC2(c3nc4ccc5ccccc5c4s3)OC(=O)C(C)(C)C(=O)O2)cc1 |
| InChI | InChI=1S/C26H21NO5S/c1-25(2)23(28)31-26(32-24(25)29,15-14-16-8-11-18(30-3)12-9-16)22-27-20-13-10-17-6-4-5-7-19(17)21(20)33-22/h4-15H,1-3H3 |
| InChIKey | WIOWGGKBUJLWPI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|