C34H44F6O5 — CID 76827222
ethyl 6-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-enyl]phenyl]pentan-3-yl]phenoxy]hexanoate (PubChem CID 76827222) has the molecular formula C34H44F6O5 and a molecular weight of 646.71 g/mol. Its IUPAC name is ethyl 6-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-enyl]phenyl]pentan-3-yl]phenoxy]hexanoate.
| Compound Name | ethyl 6-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-enyl]phenyl]pentan-3-yl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 76827222 |
| Molecular Formula | C34H44F6O5 |
| Molecular Weight | 646.71 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | ethyl 6-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-enyl]phenyl]pentan-3-yl]phenoxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1ccc(C(CC)(CC)c2ccc(C=CC(OCOC)(C(F)(F)F)C(F)(F)F)c(C)c2)cc1C |
| InChI | InChI=1S/C34H44F6O5/c1-7-31(8-2,28-16-17-29(25(5)22-28)44-20-12-10-11-13-30(41)43-9-3)27-15-14-26(24(4)21-27)18-19-32(33(35,36)37,34(38,39)40)45-23-42-6/h14-19,21-22H,7-13,20,23H2,1-6H3 |
| InChIKey | PHSYZAAMVALQQL-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.71 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|