C21H37N2+ — CID 76844423
7,8,12,13-tetramethyl-18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane (PubChem CID 76844423) has the molecular formula C21H37N2+ and a molecular weight of 317.54 g/mol. Its IUPAC name is 7,8,12,13-tetramethyl-18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane.
| Compound Name | 7,8,12,13-tetramethyl-18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane |
|---|---|
| PubChem CID | 76844423 |
| Molecular Formula | C21H37N2+ |
| Molecular Weight | 317.54 g/mol |
| Exact Mass | 317.30 |
| IUPAC Name | 7,8,12,13-tetramethyl-18-aza-19-azoniapentacyclo[9.6.1.12,6.014,18.09,19]nonadecane |
| SMILES | CC1C(C)C2CC3C(C)C(C)C4CCCC(C5CCCC1N25)[NH+]43 |
| InChI | InChI=1S/C21H36N2/c1-12-14(3)20-11-21-15(4)13(2)17-8-6-10-19(23(17)21)18-9-5-7-16(12)22(18)20/h12-21H,5-11H2,1-4H3/p+1 |
| InChIKey | YEVLKIVBDKJHCW-UHFFFAOYSA-O |
| XLogP | 2.73 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |