C12H10N3O6+ — CID 76845812
methyl 7-nitro-5-oxo-3,7-dihydro-2H-[1,3]oxazolo[2,3-b]quinazolin-4-ium-8-carboxylate (PubChem CID 76845812) has the molecular formula C12H10N3O6+ and a molecular weight of 292.23 g/mol. Its IUPAC name is methyl 7-nitro-5-oxo-3,7-dihydro-2H-[1,3]oxazolo[2,3-b]quinazolin-4-ium-8-carboxylate.
| Compound Name | methyl 7-nitro-5-oxo-3,7-dihydro-2H-[1,3]oxazolo[2,3-b]quinazolin-4-ium-8-carboxylate |
|---|---|
| PubChem CID | 76845812 |
| Molecular Formula | C12H10N3O6+ |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | methyl 7-nitro-5-oxo-3,7-dihydro-2H-[1,3]oxazolo[2,3-b]quinazolin-4-ium-8-carboxylate |
| SMILES | COC(=O)C1=CC2=NC3=[N+](CCO3)C(=O)C2=CC1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10N3O6/c1-20-11(17)7-4-8-6(5-9(7)15(18)19)10(16)14-2-3-21-12(14)13-8/h4-5,9H,2-3H2,1H3/q+1 |
| InChIKey | YLZLKNZKKVJQIB-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 111.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|