C11H7N3O2S — CID 76848051
4-thiophen-2-yl-1H-imidazo[4,5-c]pyridine-6-carboxylic acid (PubChem CID 76848051) has the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. Its IUPAC name is 4-thiophen-2-yl-1H-imidazo[4,5-c]pyridine-6-carboxylic acid.
| Compound Name | 4-thiophen-2-yl-1H-imidazo[4,5-c]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 76848051 |
| Molecular Formula | C11H7N3O2S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 4-thiophen-2-yl-1H-imidazo[4,5-c]pyridine-6-carboxylic acid |
| SMILES | O=C(O)c1cc2[nH]cnc2c(-c2cccs2)n1 |
| InChI | InChI=1S/C11H7N3O2S/c15-11(16)7-4-6-9(13-5-12-6)10(14-7)8-2-1-3-17-8/h1-5H,(H,12,13)(H,15,16) |
| InChIKey | YIHKVVXJGMFLLE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |