About 5-phenoxypyrimidine
5-phenoxypyrimidine (PubChem CID 76850150) has the molecular formula C10H8N2O
and a molecular weight of 172.19 g/mol. Its IUPAC name is 5-phenoxypyrimidine.
Molecular Properties
| Compound Name | 5-phenoxypyrimidine |
| PubChem CID | 76850150 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 5-phenoxypyrimidine |
| SMILES | c1ccc(Oc2cncnc2)cc1 |
| InChI | InChI=1S/C10H8N2O/c1-2-4-9(5-3-1)13-10-6-11-8-12-7-10/h1-8H |
| InChIKey | VQAJURRYDSTTMS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-phenoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenoxypyrimidine?
The IUPAC name of 5-phenoxypyrimidine (CID 76850150) is 5-phenoxypyrimidine.
What is the SMILES notation for 5-phenoxypyrimidine?
The canonical SMILES for 5-phenoxypyrimidine is c1ccc(Oc2cncnc2)cc1.
What is the InChIKey of 5-phenoxypyrimidine?
The InChIKey is VQAJURRYDSTTMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O/c1-2-4-9(5-3-1)13-10-6-11-8-12-7-10/h1-8H.
What are the key properties of 5-phenoxypyrimidine?
5-phenoxypyrimidine has a molecular weight of 172.19 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenoxypyrimidine is sourced from PubChem (CID 76850150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).