C20H22FN3O3S — CID 76850829
3-(4-fluorophenyl)-5-methyl-1-phenyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;methanesulfonic acid (PubChem CID 76850829) has the molecular formula C20H22FN3O3S and a molecular weight of 403.48 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-methyl-1-phenyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;methanesulfonic acid.
| Compound Name | 3-(4-fluorophenyl)-5-methyl-1-phenyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;methanesulfonic acid |
|---|---|
| PubChem CID | 76850829 |
| Molecular Formula | C20H22FN3O3S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 3-(4-fluorophenyl)-5-methyl-1-phenyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine;methanesulfonic acid |
| SMILES | CN1CCc2c(c(-c3ccc(F)cc3)nn2-c2ccccc2)C1.CS(=O)(=O)O |
| InChI | InChI=1S/C19H18FN3.CH4O3S/c1-22-12-11-18-17(13-22)19(14-7-9-15(20)10-8-14)21-23(18)16-5-3-2-4-6-16;1-5(2,3)4/h2-10H,11-13H2,1H3;1H3,(H,2,3,4) |
| InChIKey | YBWPTMQFHMZZJT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|