C18H19N5 — CID 82586033
4-(5-methyl-1-pyridin-2-yl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline (PubChem CID 82586033) has the molecular formula C18H19N5 and a molecular weight of 305.39 g/mol. Its IUPAC name is 4-(5-methyl-1-pyridin-2-yl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline.
| Compound Name | 4-(5-methyl-1-pyridin-2-yl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline |
|---|---|
| PubChem CID | 82586033 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 4-(5-methyl-1-pyridin-2-yl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline |
| SMILES | CN1CCc2c(c(-c3ccc(N)cc3)nn2-c2ccccn2)C1 |
| InChI | InChI=1S/C18H19N5/c1-22-11-9-16-15(12-22)18(13-5-7-14(19)8-6-13)21-23(16)17-4-2-3-10-20-17/h2-8,10H,9,11-12,19H2,1H3 |
| InChIKey | LTKXHWWNTAFQLW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|