C14H11N5OS — CID 76853683
1-(2,1,3-benzothiadiazol-4-yl)-3-[(E)-benzylideneamino]urea (PubChem CID 76853683) has the molecular formula C14H11N5OS and a molecular weight of 297.34 g/mol. Its IUPAC name is 1-(2,1,3-benzothiadiazol-4-yl)-3-[(E)-benzylideneamino]urea.
| Compound Name | 1-(2,1,3-benzothiadiazol-4-yl)-3-[(E)-benzylideneamino]urea |
|---|---|
| PubChem CID | 76853683 |
| Molecular Formula | C14H11N5OS |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 1-(2,1,3-benzothiadiazol-4-yl)-3-[(E)-benzylideneamino]urea |
| SMILES | O=C(N/N=C/c1ccccc1)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C14H11N5OS/c20-14(17-15-9-10-5-2-1-3-6-10)16-11-7-4-8-12-13(11)19-21-18-12/h1-9H,(H2,16,17,20)/b15-9+ |
| InChIKey | PTSCKUYGEQSUEZ-OQLLNIDSSA-N |
| XLogP | 2.85 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|