About (prop-2-enylamino) oxane-4-carboxylate
(prop-2-enylamino) oxane-4-carboxylate (PubChem CID 76854059) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is (prop-2-enylamino) oxane-4-carboxylate.
Molecular Properties
| Compound Name | (prop-2-enylamino) oxane-4-carboxylate |
| PubChem CID | 76854059 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (prop-2-enylamino) oxane-4-carboxylate |
| SMILES | C=CCNOC(=O)C1CCOCC1 |
| InChI | InChI=1S/C9H15NO3/c1-2-5-10-13-9(11)8-3-6-12-7-4-8/h2,8,10H,1,3-7H2 |
| InChIKey | JLWSMNXPHMBFEO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (prop-2-enylamino) oxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (prop-2-enylamino) oxane-4-carboxylate?
The IUPAC name of (prop-2-enylamino) oxane-4-carboxylate (CID 76854059) is (prop-2-enylamino) oxane-4-carboxylate.
What is the SMILES notation for (prop-2-enylamino) oxane-4-carboxylate?
The canonical SMILES for (prop-2-enylamino) oxane-4-carboxylate is C=CCNOC(=O)C1CCOCC1.
What is the InChIKey of (prop-2-enylamino) oxane-4-carboxylate?
The InChIKey is JLWSMNXPHMBFEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-2-5-10-13-9(11)8-3-6-12-7-4-8/h2,8,10H,1,3-7H2.
What are the key properties of (prop-2-enylamino) oxane-4-carboxylate?
(prop-2-enylamino) oxane-4-carboxylate has a molecular weight of 185.22 g/mol, XLogP of 0.65, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (prop-2-enylamino) oxane-4-carboxylate is sourced from PubChem (CID 76854059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).