About but-3-enyl (2R)-2-(oxane-4-carbonylamino)propanoate
but-3-enyl (2R)-2-(oxane-4-carbonylamino)propanoate (PubChem CID 95177981) has the molecular formula C13H21NO4
and a molecular weight of 255.31 g/mol. Its IUPAC name is but-3-enyl (2R)-2-(oxane-4-carbonylamino)propanoate.
Molecular Properties
| Compound Name | but-3-enyl (2R)-2-(oxane-4-carbonylamino)propanoate |
| PubChem CID | 95177981 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | but-3-enyl (2R)-2-(oxane-4-carbonylamino)propanoate |
| SMILES | C=CCCOC(=O)[C@@H](C)NC(=O)C1CCOCC1 |
| InChI | InChI=1S/C13H21NO4/c1-3-4-7-18-13(16)10(2)14-12(15)11-5-8-17-9-6-11/h3,10-11H,1,4-9H2,2H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | ZKYDAOWVOPZPQY-SNVBAGLBSA-N |
| XLogP | 1.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl (2R)-2-(oxane-4-carbonylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl (2R)-2-(oxane-4-carbonylamino)propanoate?
The IUPAC name of but-3-enyl (2R)-2-(oxane-4-carbonylamino)propanoate (CID 95177981) is but-3-enyl (2R)-2-(oxane-4-carbonylamino)propanoate.
What is the SMILES notation for but-3-enyl (2R)-2-(oxane-4-carbonylamino)propanoate?
The canonical SMILES for but-3-enyl (2R)-2-(oxane-4-carbonylamino)propanoate is C=CCCOC(=O)[C@@H](C)NC(=O)C1CCOCC1.
What is the InChIKey of but-3-enyl (2R)-2-(oxane-4-carbonylamino)propanoate?
The InChIKey is ZKYDAOWVOPZPQY-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H21NO4/c1-3-4-7-18-13(16)10(2)14-12(15)11-5-8-17-9-6-11/h3,10-11H,1,4-9H2,2H3,(H,14,15)/t10-/m1/s1.
What are the key properties of but-3-enyl (2R)-2-(oxane-4-carbonylamino)propanoate?
but-3-enyl (2R)-2-(oxane-4-carbonylamino)propanoate has a molecular weight of 255.31 g/mol, XLogP of 1.04, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl (2R)-2-(oxane-4-carbonylamino)propanoate is sourced from PubChem (CID 95177981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).