C14H23NO3 — CID 97003915
but-3-enyl (2R)-2-[(2-cyclopentylacetyl)amino]propanoate (PubChem CID 97003915) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is but-3-enyl (2R)-2-[(2-cyclopentylacetyl)amino]propanoate.
| Compound Name | but-3-enyl (2R)-2-[(2-cyclopentylacetyl)amino]propanoate |
|---|---|
| PubChem CID | 97003915 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | but-3-enyl (2R)-2-[(2-cyclopentylacetyl)amino]propanoate |
| SMILES | C=CCCOC(=O)[C@@H](C)NC(=O)CC1CCCC1 |
| InChI | InChI=1S/C14H23NO3/c1-3-4-9-18-14(17)11(2)15-13(16)10-12-7-5-6-8-12/h3,11-12H,1,4-10H2,2H3,(H,15,16)/t11-/m1/s1 |
| InChIKey | BFKRIEIVBLDXPH-LLVKDONJSA-N |
| XLogP | 2.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|