C18H22O3 — CID 76855279
but-2-enyl 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoate (PubChem CID 76855279) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is but-2-enyl 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoate.
| Compound Name | but-2-enyl 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoate |
|---|---|
| PubChem CID | 76855279 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | but-2-enyl 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoate |
| SMILES | CC=CCOC(=O)CCC(=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H22O3/c1-2-3-12-21-18(20)11-10-17(19)16-9-8-14-6-4-5-7-15(14)13-16/h2-3,8-9,13H,4-7,10-12H2,1H3 |
| InChIKey | DYQBCDMFWJXDJP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|