C19H18Cl2N4O — CID 76871043
3-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]-1-(1-ethylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 76871043) has the molecular formula C19H18Cl2N4O and a molecular weight of 389.29 g/mol. Its IUPAC name is 3-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]-1-(1-ethylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | 3-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]-1-(1-ethylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 76871043 |
| Molecular Formula | C19H18Cl2N4O |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 3-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]-1-(1-ethylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | CCn1cc(C(=O)C=Cc2c(C)nn(Cc3ccc(Cl)cc3)c2Cl)cn1 |
| InChI | InChI=1S/C19H18Cl2N4O/c1-3-24-12-15(10-22-24)18(26)9-8-17-13(2)23-25(19(17)21)11-14-4-6-16(20)7-5-14/h4-10,12H,3,11H2,1-2H3 |
| InChIKey | GNXASXLQHCHBQS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|