C23H22ClFN2O4 — CID 46800527
(E)-3-[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 46800527) has the molecular formula C23H22ClFN2O4 and a molecular weight of 444.89 g/mol. Its IUPAC name is (E)-3-[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 46800527 |
| Molecular Formula | C23H22ClFN2O4 |
| Molecular Weight | 444.89 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (E)-3-[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)/C=C/c2c(C)nn(Cc3ccc(F)cc3)c2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C23H22ClFN2O4/c1-14-18(23(24)27(26-14)13-15-5-7-17(25)8-6-15)9-10-19(28)16-11-20(29-2)22(31-4)21(12-16)30-3/h5-12H,13H2,1-4H3/b10-9+ |
| InChIKey | VWQFBLHGERUNHY-MDZDMXLPSA-N |
| XLogP | 4.95 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.89 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|