C7H10N6 — CID 7688192
N,N,3-trimethyltriazolo[4,5-d]pyrimidin-7-amine (PubChem CID 7688192) has the molecular formula C7H10N6 and a molecular weight of 178.20 g/mol. Its IUPAC name is N,N,3-trimethyltriazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | N,N,3-trimethyltriazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 7688192 |
| Molecular Formula | C7H10N6 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | N,N,3-trimethyltriazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CN(C)c1ncnc2c1nnn2C |
| InChI | InChI=1S/C7H10N6/c1-12(2)6-5-7(9-4-8-6)13(3)11-10-5/h4H,1-3H3 |
| InChIKey | BNJLNFUULXTSPT-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |