C13H11F2N3OS — CID 76916377
2-(2,4-difluorophenyl)sulfanyl-N'-hydroxy-6-methylpyridine-3-carboximidamide (PubChem CID 76916377) has the molecular formula C13H11F2N3OS and a molecular weight of 295.31 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-N'-hydroxy-6-methylpyridine-3-carboximidamide.
| Compound Name | 2-(2,4-difluorophenyl)sulfanyl-N'-hydroxy-6-methylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 76916377 |
| Molecular Formula | C13H11F2N3OS |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanyl-N'-hydroxy-6-methylpyridine-3-carboximidamide |
| SMILES | Cc1ccc(C(N)=NO)c(Sc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C13H11F2N3OS/c1-7-2-4-9(12(16)18-19)13(17-7)20-11-5-3-8(14)6-10(11)15/h2-6,19H,1H3,(H2,16,18) |
| InChIKey | GKEYPWRYTHVBPK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|