C9H13N3O2S — CID 76916406
N'-hydroxy-2-(2-hydroxyethylsulfanyl)-6-methylpyridine-3-carboximidamide (PubChem CID 76916406) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is N'-hydroxy-2-(2-hydroxyethylsulfanyl)-6-methylpyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-2-(2-hydroxyethylsulfanyl)-6-methylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 76916406 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | N'-hydroxy-2-(2-hydroxyethylsulfanyl)-6-methylpyridine-3-carboximidamide |
| SMILES | Cc1ccc(C(N)=NO)c(SCCO)n1 |
| InChI | InChI=1S/C9H13N3O2S/c1-6-2-3-7(8(10)12-14)9(11-6)15-5-4-13/h2-3,13-14H,4-5H2,1H3,(H2,10,12) |
| InChIKey | NLPPZZCYSOTQSX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|