C16H16O4S — CID 76917718
3-[2-[(2-ethoxyphenoxy)methyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 76917718) has the molecular formula C16H16O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is 3-[2-[(2-ethoxyphenoxy)methyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[2-[(2-ethoxyphenoxy)methyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76917718 |
| Molecular Formula | C16H16O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-[2-[(2-ethoxyphenoxy)methyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | CCOc1ccccc1OCc1sccc1C=CC(=O)O |
| InChI | InChI=1S/C16H16O4S/c1-2-19-13-5-3-4-6-14(13)20-11-15-12(9-10-21-15)7-8-16(17)18/h3-10H,2,11H2,1H3,(H,17,18) |
| InChIKey | XFUQQHNLBCMDIK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|