C12H16O3S — CID 76918369
3-[2-(butoxymethyl)thiophen-3-yl]prop-2-enoic acid (PubChem CID 76918369) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 3-[2-(butoxymethyl)thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[2-(butoxymethyl)thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76918369 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 3-[2-(butoxymethyl)thiophen-3-yl]prop-2-enoic acid |
| SMILES | CCCCOCc1sccc1C=CC(=O)O |
| InChI | InChI=1S/C12H16O3S/c1-2-3-7-15-9-11-10(6-8-16-11)4-5-12(13)14/h4-6,8H,2-3,7,9H2,1H3,(H,13,14) |
| InChIKey | BWPINYKXISZSLQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|