C12H12ClN — CID 76922430
3-chloro-3-(3,4-dimethylphenyl)-2-methylprop-2-enenitrile (PubChem CID 76922430) has the molecular formula C12H12ClN and a molecular weight of 205.69 g/mol. Its IUPAC name is 3-chloro-3-(3,4-dimethylphenyl)-2-methylprop-2-enenitrile.
| Compound Name | 3-chloro-3-(3,4-dimethylphenyl)-2-methylprop-2-enenitrile |
|---|---|
| PubChem CID | 76922430 |
| Molecular Formula | C12H12ClN |
| Molecular Weight | 205.69 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-chloro-3-(3,4-dimethylphenyl)-2-methylprop-2-enenitrile |
| SMILES | CC(C#N)=C(Cl)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C12H12ClN/c1-8-4-5-11(6-9(8)2)12(13)10(3)7-14/h4-6H,1-3H3 |
| InChIKey | VQAKSFQCDVFOJE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.69 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|