C10H6ClF2N — CID 76922482
3-chloro-3-(3,4-difluorophenyl)-2-methylprop-2-enenitrile (PubChem CID 76922482) has the molecular formula C10H6ClF2N and a molecular weight of 213.61 g/mol. Its IUPAC name is 3-chloro-3-(3,4-difluorophenyl)-2-methylprop-2-enenitrile.
| Compound Name | 3-chloro-3-(3,4-difluorophenyl)-2-methylprop-2-enenitrile |
|---|---|
| PubChem CID | 76922482 |
| Molecular Formula | C10H6ClF2N |
| Molecular Weight | 213.61 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 3-chloro-3-(3,4-difluorophenyl)-2-methylprop-2-enenitrile |
| SMILES | CC(C#N)=C(Cl)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H6ClF2N/c1-6(5-14)10(11)7-2-3-8(12)9(13)4-7/h2-4H,1H3 |
| InChIKey | PFVAPJBIRINXML-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.61 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|