C16H20ClN4O2+ — CID 7692733
6-[(2R)-butan-2-yl]-1-(4-chlorophenyl)-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione (PubChem CID 7692733) has the molecular formula C16H20ClN4O2+ and a molecular weight of 335.82 g/mol. Its IUPAC name is 6-[(2R)-butan-2-yl]-1-(4-chlorophenyl)-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione.
| Compound Name | 6-[(2R)-butan-2-yl]-1-(4-chlorophenyl)-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione |
|---|---|
| PubChem CID | 7692733 |
| Molecular Formula | C16H20ClN4O2+ |
| Molecular Weight | 335.82 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 6-[(2R)-butan-2-yl]-1-(4-chlorophenyl)-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione |
| SMILES | CC[C@@H](C)[NH+]1CNc2c(c(=O)[nH]c(=O)n2-c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H19ClN4O2/c1-3-10(2)20-8-13-14(18-9-20)21(16(23)19-15(13)22)12-6-4-11(17)5-7-12/h4-7,10,18H,3,8-9H2,1-2H3,(H,19,22,23)/p+1/t10-/m1/s1 |
| InChIKey | QXWLVOVJKWOIRU-SNVBAGLBSA-O |
| XLogP | 0.75 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.82 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |