C19H21N4O3+ — CID 7710458
1-(3,4-dimethylphenyl)-6-(furan-2-ylmethyl)-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione (PubChem CID 7710458) has the molecular formula C19H21N4O3+ and a molecular weight of 353.40 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-6-(furan-2-ylmethyl)-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione.
| Compound Name | 1-(3,4-dimethylphenyl)-6-(furan-2-ylmethyl)-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione |
|---|---|
| PubChem CID | 7710458 |
| Molecular Formula | C19H21N4O3+ |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-6-(furan-2-ylmethyl)-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione |
| SMILES | Cc1ccc(-n2c3c(c(=O)[nH]c2=O)C[NH+](Cc2ccco2)CN3)cc1C |
| InChI | InChI=1S/C19H20N4O3/c1-12-5-6-14(8-13(12)2)23-17-16(18(24)21-19(23)25)10-22(11-20-17)9-15-4-3-7-26-15/h3-8,20H,9-11H2,1-2H3,(H,21,24,25)/p+1 |
| InChIKey | FLRCAFBHYJYHTE-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |