C20H27N4O2+ — CID 7711016
6-cyclohexyl-1-(2,3-dimethylphenyl)-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione (PubChem CID 7711016) has the molecular formula C20H27N4O2+ and a molecular weight of 355.46 g/mol. Its IUPAC name is 6-cyclohexyl-1-(2,3-dimethylphenyl)-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione.
| Compound Name | 6-cyclohexyl-1-(2,3-dimethylphenyl)-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione |
|---|---|
| PubChem CID | 7711016 |
| Molecular Formula | C20H27N4O2+ |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 6-cyclohexyl-1-(2,3-dimethylphenyl)-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione |
| SMILES | Cc1cccc(-n2c3c(c(=O)[nH]c2=O)C[NH+](C2CCCCC2)CN3)c1C |
| InChI | InChI=1S/C20H26N4O2/c1-13-7-6-10-17(14(13)2)24-18-16(19(25)22-20(24)26)11-23(12-21-18)15-8-4-3-5-9-15/h6-7,10,15,21H,3-5,8-9,11-12H2,1-2H3,(H,22,25,26)/p+1 |
| InChIKey | MWKVXABLXIAZID-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |