C19H24ClN4O2+ — CID 7711052
1-[(2-chlorophenyl)methyl]-6-cyclohexyl-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione (PubChem CID 7711052) has the molecular formula C19H24ClN4O2+ and a molecular weight of 375.88 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-6-cyclohexyl-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione.
| Compound Name | 1-[(2-chlorophenyl)methyl]-6-cyclohexyl-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione |
|---|---|
| PubChem CID | 7711052 |
| Molecular Formula | C19H24ClN4O2+ |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-6-cyclohexyl-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccccc2Cl)c2c1C[NH+](C1CCCCC1)CN2 |
| InChI | InChI=1S/C19H23ClN4O2/c20-16-9-5-4-6-13(16)10-24-17-15(18(25)22-19(24)26)11-23(12-21-17)14-7-2-1-3-8-14/h4-6,9,14,21H,1-3,7-8,10-12H2,(H,22,25,26)/p+1 |
| InChIKey | BUICPCPPHNIRFJ-UHFFFAOYSA-O |
| XLogP | 1.34 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |