C21H14ClN5O4 — CID 177454433
1-[(2-chlorophenyl)methyl]-6-(2-hydroxyphenyl)-2,4,8-trioxo-5,9-dihydropyrimido[4,5-b][1,4]diazepine-7-carbonitrile (PubChem CID 177454433) has the molecular formula C21H14ClN5O4 and a molecular weight of 435.83 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-6-(2-hydroxyphenyl)-2,4,8-trioxo-5,9-dihydropyrimido[4,5-b][1,4]diazepine-7-carbonitrile.
| Compound Name | 1-[(2-chlorophenyl)methyl]-6-(2-hydroxyphenyl)-2,4,8-trioxo-5,9-dihydropyrimido[4,5-b][1,4]diazepine-7-carbonitrile |
|---|---|
| PubChem CID | 177454433 |
| Molecular Formula | C21H14ClN5O4 |
| Molecular Weight | 435.83 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-6-(2-hydroxyphenyl)-2,4,8-trioxo-5,9-dihydropyrimido[4,5-b][1,4]diazepine-7-carbonitrile |
| SMILES | N#CC1=C(c2ccccc2O)Nc2c(n(Cc3ccccc3Cl)c(=O)[nH]c2=O)NC1=O |
| InChI | InChI=1S/C21H14ClN5O4/c22-14-7-3-1-5-11(14)10-27-18-17(20(30)26-21(27)31)24-16(13(9-23)19(29)25-18)12-6-2-4-8-15(12)28/h1-8,24,28H,10H2,(H,25,29)(H,26,30,31) |
| InChIKey | GDAHHFGHTMZKME-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 140.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.83 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |