C18H22ClN4O2+ — CID 7680082
1-(3-chlorophenyl)-6-cyclohexyl-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione (PubChem CID 7680082) has the molecular formula C18H22ClN4O2+ and a molecular weight of 361.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-6-cyclohexyl-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione.
| Compound Name | 1-(3-chlorophenyl)-6-cyclohexyl-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione |
|---|---|
| PubChem CID | 7680082 |
| Molecular Formula | C18H22ClN4O2+ |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-(3-chlorophenyl)-6-cyclohexyl-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-6-ium-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2cccc(Cl)c2)c2c1C[NH+](C1CCCCC1)CN2 |
| InChI | InChI=1S/C18H21ClN4O2/c19-12-5-4-8-14(9-12)23-16-15(17(24)21-18(23)25)10-22(11-20-16)13-6-2-1-3-7-13/h4-5,8-9,13,20H,1-3,6-7,10-11H2,(H,21,24,25)/p+1 |
| InChIKey | AIAKFHMMWKBIPH-UHFFFAOYSA-O |
| XLogP | 1.28 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |