C9H17N3O2 — CID 76928487
3-amino-N-(2,2-dimethylcyclopropyl)-3-hydroxyimino-2-methylpropanamide (PubChem CID 76928487) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-amino-N-(2,2-dimethylcyclopropyl)-3-hydroxyimino-2-methylpropanamide.
| Compound Name | 3-amino-N-(2,2-dimethylcyclopropyl)-3-hydroxyimino-2-methylpropanamide |
|---|---|
| PubChem CID | 76928487 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 3-amino-N-(2,2-dimethylcyclopropyl)-3-hydroxyimino-2-methylpropanamide |
| SMILES | CC(C(=O)NC1CC1(C)C)C(N)=NO |
| InChI | InChI=1S/C9H17N3O2/c1-5(7(10)12-14)8(13)11-6-4-9(6,2)3/h5-6,14H,4H2,1-3H3,(H2,10,12)(H,11,13) |
| InChIKey | YKSKVXHDXGMLRP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|