C10H21N3O2 — CID 76929154
N-(2-amino-2-hydroxyiminoethyl)-N,2-diethylbutanamide (PubChem CID 76929154) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(2-amino-2-hydroxyiminoethyl)-N,2-diethylbutanamide.
| Compound Name | N-(2-amino-2-hydroxyiminoethyl)-N,2-diethylbutanamide |
|---|---|
| PubChem CID | 76929154 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | N-(2-amino-2-hydroxyiminoethyl)-N,2-diethylbutanamide |
| SMILES | CCC(CC)C(=O)N(CC)CC(N)=NO |
| InChI | InChI=1S/C10H21N3O2/c1-4-8(5-2)10(14)13(6-3)7-9(11)12-15/h8,15H,4-7H2,1-3H3,(H2,11,12) |
| InChIKey | WUKFMYCZIFKYAY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|