C12H16N2O4 — CID 76929527
4-(cyclohex-3-en-1-ylmethylcarbamoylamino)-4-oxobut-2-enoic acid (PubChem CID 76929527) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 4-(cyclohex-3-en-1-ylmethylcarbamoylamino)-4-oxobut-2-enoic acid.
| Compound Name | 4-(cyclohex-3-en-1-ylmethylcarbamoylamino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76929527 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 4-(cyclohex-3-en-1-ylmethylcarbamoylamino)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)NC(=O)NCC1CC=CCC1 |
| InChI | InChI=1S/C12H16N2O4/c15-10(6-7-11(16)17)14-12(18)13-8-9-4-2-1-3-5-9/h1-2,6-7,9H,3-5,8H2,(H,16,17)(H2,13,14,15,18) |
| InChIKey | RBZUMTXMBWCLOM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|