C20H20N4O5 — CID 7696632
(2S)-2-[[(3S)-2-acetyl-5-(3-nitrophenyl)-3,4-dihydropyrazol-3-yl]azaniumyl]-3-phenylpropanoate (PubChem CID 7696632) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is (2S)-2-[[(3S)-2-acetyl-5-(3-nitrophenyl)-3,4-dihydropyrazol-3-yl]azaniumyl]-3-phenylpropanoate.
| Compound Name | (2S)-2-[[(3S)-2-acetyl-5-(3-nitrophenyl)-3,4-dihydropyrazol-3-yl]azaniumyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 7696632 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (2S)-2-[[(3S)-2-acetyl-5-(3-nitrophenyl)-3,4-dihydropyrazol-3-yl]azaniumyl]-3-phenylpropanoate |
| SMILES | CC(=O)N1N=C(c2cccc([N+](=O)[O-])c2)C[C@H]1[NH2+][C@@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C20H20N4O5/c1-13(25)23-19(21-18(20(26)27)10-14-6-3-2-4-7-14)12-17(22-23)15-8-5-9-16(11-15)24(28)29/h2-9,11,18-19,21H,10,12H2,1H3,(H,26,27)/t18-,19-/m0/s1 |
| InChIKey | NYDFVUOGOFWVFR-OALUTQOASA-N |
| XLogP | -0.20 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|