C23H22N4O4 — CID 11836519
ethyl (E)-3-[3-(1H-indol-3-yl)-5-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]but-2-enoate (PubChem CID 11836519) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is ethyl (E)-3-[3-(1H-indol-3-yl)-5-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]but-2-enoate.
| Compound Name | ethyl (E)-3-[3-(1H-indol-3-yl)-5-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 11836519 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | ethyl (E)-3-[3-(1H-indol-3-yl)-5-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)N1N=C(c2cccc([N+](=O)[O-])c2)CC1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H22N4O4/c1-3-31-23(28)11-15(2)26-22(19-14-24-20-10-5-4-9-18(19)20)13-21(25-26)16-7-6-8-17(12-16)27(29)30/h4-12,14,22,24H,3,13H2,1-2H3/b15-11+ |
| InChIKey | BZKJFQNHVMHUPB-RVDMUPIBSA-N |
| XLogP | 4.69 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|