C24H16ClN5O3 — CID 171348084
[3-(2-chloroquinolin-3-yl)-5-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-pyridin-4-ylmethanone (PubChem CID 171348084) has the molecular formula C24H16ClN5O3 and a molecular weight of 457.88 g/mol. Its IUPAC name is [3-(2-chloroquinolin-3-yl)-5-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-pyridin-4-ylmethanone.
| Compound Name | [3-(2-chloroquinolin-3-yl)-5-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 171348084 |
| Molecular Formula | C24H16ClN5O3 |
| Molecular Weight | 457.88 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | [3-(2-chloroquinolin-3-yl)-5-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1N=C(c2cccc([N+](=O)[O-])c2)CC1c1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C24H16ClN5O3/c25-23-19(13-17-4-1-2-7-20(17)27-23)22-14-21(16-5-3-6-18(12-16)30(32)33)28-29(22)24(31)15-8-10-26-11-9-15/h1-13,22H,14H2 |
| InChIKey | OGWHGNIFOHDZKK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 101.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.88 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|