C10H20Cl2 — CID 76974059
1,10-dichloro-1,1,10,10-tetradeuteriodecane (PubChem CID 76974059) has the molecular formula C10H20Cl2 and a molecular weight of 215.20 g/mol. Its IUPAC name is 1,10-dichloro-1,1,10,10-tetradeuteriodecane.
| Compound Name | 1,10-dichloro-1,1,10,10-tetradeuteriodecane |
|---|---|
| PubChem CID | 76974059 |
| Molecular Formula | C10H20Cl2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1,10-dichloro-1,1,10,10-tetradeuteriodecane |
| SMILES | [2H]C([2H])(Cl)CCCCCCCCC([2H])([2H])Cl |
| InChI | InChI=1S/C10H20Cl2/c11-9-7-5-3-1-2-4-6-8-10-12/h1-10H2/i9D2,10D2 |
| InChIKey | RBBNTRDPSVZESY-YQUBHJMPSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|