C14H14Cl2N2O2 — CID 76976955
3-(3,5-dichlorophenyl)-N-(6-oxopiperidin-3-yl)prop-2-enamide (PubChem CID 76976955) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-N-(6-oxopiperidin-3-yl)prop-2-enamide.
| Compound Name | 3-(3,5-dichlorophenyl)-N-(6-oxopiperidin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 76976955 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-N-(6-oxopiperidin-3-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1cc(Cl)cc(Cl)c1)NC1CCC(=O)NC1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c15-10-5-9(6-11(16)7-10)1-3-14(20)18-12-2-4-13(19)17-8-12/h1,3,5-7,12H,2,4,8H2,(H,17,19)(H,18,20) |
| InChIKey | LLAOKNUTCVDOEW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|