C15H17F2NO2 — CID 76983609
3-[4-[ethyl(2-methylprop-2-enyl)amino]-3,5-difluorophenyl]prop-2-enoic acid (PubChem CID 76983609) has the molecular formula C15H17F2NO2 and a molecular weight of 281.30 g/mol. Its IUPAC name is 3-[4-[ethyl(2-methylprop-2-enyl)amino]-3,5-difluorophenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[ethyl(2-methylprop-2-enyl)amino]-3,5-difluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76983609 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-[4-[ethyl(2-methylprop-2-enyl)amino]-3,5-difluorophenyl]prop-2-enoic acid |
| SMILES | C=C(C)CN(CC)c1c(F)cc(C=CC(=O)O)cc1F |
| InChI | InChI=1S/C15H17F2NO2/c1-4-18(9-10(2)3)15-12(16)7-11(8-13(15)17)5-6-14(19)20/h5-8H,2,4,9H2,1,3H3,(H,19,20) |
| InChIKey | KINPFCNJRFHWKB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|