C12H16F2N4O2 — CID 76987456
1-(4-amino-4-hydroxyiminobutan-2-yl)-3-(2,4-difluorophenyl)-1-methylurea (PubChem CID 76987456) has the molecular formula C12H16F2N4O2 and a molecular weight of 286.28 g/mol. Its IUPAC name is 1-(4-amino-4-hydroxyiminobutan-2-yl)-3-(2,4-difluorophenyl)-1-methylurea.
| Compound Name | 1-(4-amino-4-hydroxyiminobutan-2-yl)-3-(2,4-difluorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 76987456 |
| Molecular Formula | C12H16F2N4O2 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-(4-amino-4-hydroxyiminobutan-2-yl)-3-(2,4-difluorophenyl)-1-methylurea |
| SMILES | CC(CC(N)=NO)N(C)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C12H16F2N4O2/c1-7(5-11(15)17-20)18(2)12(19)16-10-4-3-8(13)6-9(10)14/h3-4,6-7,20H,5H2,1-2H3,(H2,15,17)(H,16,19) |
| InChIKey | XESGKWGIGPDZSH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|