C11H17NO — CID 76997431
4-(2,5-dimethylfuran-3-yl)pent-3-en-1-amine (PubChem CID 76997431) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-(2,5-dimethylfuran-3-yl)pent-3-en-1-amine.
| Compound Name | 4-(2,5-dimethylfuran-3-yl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 76997431 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4-(2,5-dimethylfuran-3-yl)pent-3-en-1-amine |
| SMILES | CC(=CCCN)c1cc(C)oc1C |
| InChI | InChI=1S/C11H17NO/c1-8(5-4-6-12)11-7-9(2)13-10(11)3/h5,7H,4,6,12H2,1-3H3 |
| InChIKey | UBHUTFIHYBAWEU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |