C7H7LiO3 — CID 58078185
lithium 2,5-dimethylfuran-3-carboxylate (PubChem CID 58078185) has the molecular formula C7H7LiO3 and a molecular weight of 146.07 g/mol. Its IUPAC name is lithium 2,5-dimethylfuran-3-carboxylate.
| Compound Name | lithium 2,5-dimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 58078185 |
| Molecular Formula | C7H7LiO3 |
| Molecular Weight | 146.07 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | lithium 2,5-dimethylfuran-3-carboxylate |
| SMILES | Cc1cc(C(=O)[O-])c(C)o1.[Li+] |
| InChI | InChI=1S/C7H8O3.Li/c1-4-3-6(7(8)9)5(2)10-4;/h3H,1-2H3,(H,8,9);/q;+1/p-1 |
| InChIKey | VCFJHWXDENYMTM-UHFFFAOYSA-M |
| XLogP | -2.74 |
| TPSA | 53.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.07 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |