2,5-dimethylfuran-3-carbonyl isothiocyanate

C8H7NO2S — CID 15082556

IUPAC2,5-dimethylfuran-3-carbonyl isothiocyanate
SMILESCc1cc(C(=O)N=C=S)c(C)o1
InChIInChI=1S/C8H7NO2S/c1-5-3-7(6(2)11-5)8(10)9-4-12/h3H,1-2H3
InChIKeyJOAVZCNCBUUTQA-UHFFFAOYSA-N
MW181.22 g/mol
LogP2.14
Rot. Bonds1

About 2,5-dimethylfuran-3-carbonyl isothiocyanate

2,5-dimethylfuran-3-carbonyl isothiocyanate (PubChem CID 15082556) has the molecular formula C8H7NO2S and a molecular weight of 181.22 g/mol. Its IUPAC name is 2,5-dimethylfuran-3-carbonyl isothiocyanate.

Molecular Properties

Compound Name2,5-dimethylfuran-3-carbonyl isothiocyanate
PubChem CID15082556
Molecular FormulaC8H7NO2S
Molecular Weight181.22 g/mol
Exact Mass181.02
IUPAC Name2,5-dimethylfuran-3-carbonyl isothiocyanate
SMILESCc1cc(C(=O)N=C=S)c(C)o1
InChIInChI=1S/C8H7NO2S/c1-5-3-7(6(2)11-5)8(10)9-4-12/h3H,1-2H3
InChIKeyJOAVZCNCBUUTQA-UHFFFAOYSA-N
XLogP2.14
TPSA42.57 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.22
LogP ≤ 52.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze 2,5-dimethylfuran-3-carbonyl isothiocyanate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dimethylfuran-3-carbonyl isothiocyanate?
The IUPAC name of 2,5-dimethylfuran-3-carbonyl isothiocyanate (CID 15082556) is 2,5-dimethylfuran-3-carbonyl isothiocyanate.
What is the SMILES notation for 2,5-dimethylfuran-3-carbonyl isothiocyanate?
The canonical SMILES for 2,5-dimethylfuran-3-carbonyl isothiocyanate is Cc1cc(C(=O)N=C=S)c(C)o1.
What is the InChIKey of 2,5-dimethylfuran-3-carbonyl isothiocyanate?
The InChIKey is JOAVZCNCBUUTQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2S/c1-5-3-7(6(2)11-5)8(10)9-4-12/h3H,1-2H3.
What are the key properties of 2,5-dimethylfuran-3-carbonyl isothiocyanate?
2,5-dimethylfuran-3-carbonyl isothiocyanate has a molecular weight of 181.22 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylfuran-3-carbonyl isothiocyanate is sourced from PubChem (CID 15082556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).