C8H7NO2S — CID 15082556
2,5-dimethylfuran-3-carbonyl isothiocyanate (PubChem CID 15082556) has the molecular formula C8H7NO2S and a molecular weight of 181.22 g/mol. Its IUPAC name is 2,5-dimethylfuran-3-carbonyl isothiocyanate.
| Compound Name | 2,5-dimethylfuran-3-carbonyl isothiocyanate |
|---|---|
| PubChem CID | 15082556 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 2,5-dimethylfuran-3-carbonyl isothiocyanate |
| SMILES | Cc1cc(C(=O)N=C=S)c(C)o1 |
| InChI | InChI=1S/C8H7NO2S/c1-5-3-7(6(2)11-5)8(10)9-4-12/h3H,1-2H3 |
| InChIKey | JOAVZCNCBUUTQA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|