C14H17NO2 — CID 76999886
4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)but-2-enoic acid (PubChem CID 76999886) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)but-2-enoic acid.
| Compound Name | 4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 76999886 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)but-2-enoic acid |
| SMILES | CC1Cc2ccccc2N(CC=CC(=O)O)C1 |
| InChI | InChI=1S/C14H17NO2/c1-11-9-12-5-2-3-6-13(12)15(10-11)8-4-7-14(16)17/h2-7,11H,8-10H2,1H3,(H,16,17) |
| InChIKey | FBBHWMFAPLFNRU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|