C12H15N7O2 — CID 77001396
2-[4-(N'-hydroxycarbamimidoyl)phenyl]-N-[1-(2H-tetrazol-5-yl)ethyl]acetamide (PubChem CID 77001396) has the molecular formula C12H15N7O2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-[4-(N'-hydroxycarbamimidoyl)phenyl]-N-[1-(2H-tetrazol-5-yl)ethyl]acetamide.
| Compound Name | 2-[4-(N'-hydroxycarbamimidoyl)phenyl]-N-[1-(2H-tetrazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 77001396 |
| Molecular Formula | C12H15N7O2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-[4-(N'-hydroxycarbamimidoyl)phenyl]-N-[1-(2H-tetrazol-5-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)Cc1ccc(C(N)=NO)cc1)c1nn[nH]n1 |
| InChI | InChI=1S/C12H15N7O2/c1-7(12-15-18-19-16-12)14-10(20)6-8-2-4-9(5-3-8)11(13)17-21/h2-5,7,21H,6H2,1H3,(H2,13,17)(H,14,20)(H,15,16,18,19) |
| InChIKey | BVXYFOZYAPVXBL-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|