C7H15N3O4S — CID 77015123
N-(1-amino-1-hydroxyiminopropan-2-yl)-N-methyl-2-methylsulfonylacetamide (PubChem CID 77015123) has the molecular formula C7H15N3O4S and a molecular weight of 237.28 g/mol. Its IUPAC name is N-(1-amino-1-hydroxyiminopropan-2-yl)-N-methyl-2-methylsulfonylacetamide.
| Compound Name | N-(1-amino-1-hydroxyiminopropan-2-yl)-N-methyl-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 77015123 |
| Molecular Formula | C7H15N3O4S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | N-(1-amino-1-hydroxyiminopropan-2-yl)-N-methyl-2-methylsulfonylacetamide |
| SMILES | CC(C(N)=NO)N(C)C(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C7H15N3O4S/c1-5(7(8)9-12)10(2)6(11)4-15(3,13)14/h5,12H,4H2,1-3H3,(H2,8,9) |
| InChIKey | QJWVFJILUNWRLG-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|