C14H21N3O3 — CID 77025598
3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-N'-hydroxybutanimidamide (PubChem CID 77025598) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-N'-hydroxybutanimidamide.
| Compound Name | 3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 77025598 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-N'-hydroxybutanimidamide |
| SMILES | CC(CC(N)=NO)NCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H21N3O3/c1-10(8-14(15)17-18)16-5-4-11-2-3-12-13(9-11)20-7-6-19-12/h2-3,9-10,16,18H,4-8H2,1H3,(H2,15,17) |
| InChIKey | ZZONRQKIJNCZMA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|