C13H19N3O4S — CID 77026918
4-[2-[(1,1-dioxothiolan-3-yl)amino]ethoxy]-N'-hydroxybenzenecarboximidamide (PubChem CID 77026918) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 4-[2-[(1,1-dioxothiolan-3-yl)amino]ethoxy]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[2-[(1,1-dioxothiolan-3-yl)amino]ethoxy]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77026918 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-[2-[(1,1-dioxothiolan-3-yl)amino]ethoxy]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(OCCNC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H19N3O4S/c14-13(16-17)10-1-3-12(4-2-10)20-7-6-15-11-5-8-21(18,19)9-11/h1-4,11,15,17H,5-9H2,(H2,14,16) |
| InChIKey | HLDGQBJLRYUENW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|